C25H21N3O3 — CID 139178035
2-[4-(diethylamino)-2-hydroxyphenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 139178035) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[4-(diethylamino)-2-hydroxyphenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[4-(diethylamino)-2-hydroxyphenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 139178035 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[4-(diethylamino)-2-hydroxyphenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | CCN(CC)c1ccc(-c2nc3c4c(ccc3[nH]2)C(=O)c2ccccc2C4=O)c(O)c1 |
| InChI | InChI=1S/C25H21N3O3/c1-3-28(4-2)14-9-10-17(20(29)13-14)25-26-19-12-11-18-21(22(19)27-25)24(31)16-8-6-5-7-15(16)23(18)30/h5-13,29H,3-4H2,1-2H3,(H,26,27) |
| InChIKey | CEDXKBRESKNKAW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|