C11H16N2O5 — CID 11821202
3-[(2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 11821202) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-[(2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11821202 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-[(2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H]2N[C@H]2C(=O)N2CCOC2=O)O1 |
| InChI | InChI=1S/C11H16N2O5/c1-11(2)17-5-6(18-11)7-8(12-7)9(14)13-3-4-16-10(13)15/h6-8,12H,3-5H2,1-2H3/t6-,7+,8-/m1/s1 |
| InChIKey | WEADFBFQOSOENY-GJMOJQLCSA-N |
| XLogP | -0.54 |
| TPSA | 87.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|