C18H24N2O6 — CID 11013955
3-[(3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(phenylmethoxyamino)propanoyl]-1,3-oxazolidin-2-one (PubChem CID 11013955) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[(3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(phenylmethoxyamino)propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(phenylmethoxyamino)propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11013955 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3-[(3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(phenylmethoxyamino)propanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC[C@H]([C@H](CC(=O)N2CCOC2=O)NOCc2ccccc2)O1 |
| InChI | InChI=1S/C18H24N2O6/c1-18(2)24-12-15(26-18)14(10-16(21)20-8-9-23-17(20)22)19-25-11-13-6-4-3-5-7-13/h3-7,14-15,19H,8-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | FKDAMDPEVWGZND-LSDHHAIUSA-N |
| XLogP | 1.60 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|