C21H30ClNO4 — CID 11452241
3-[(3R)-7-chloro-4,4-dimethyl-3-(2-phenylmethoxyethyl)heptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11452241) has the molecular formula C21H30ClNO4 and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-[(3R)-7-chloro-4,4-dimethyl-3-(2-phenylmethoxyethyl)heptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3R)-7-chloro-4,4-dimethyl-3-(2-phenylmethoxyethyl)heptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11452241 |
| Molecular Formula | C21H30ClNO4 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-[(3R)-7-chloro-4,4-dimethyl-3-(2-phenylmethoxyethyl)heptanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(CCCCl)C(CCOCc1ccccc1)CC(=O)N1CCOC1=O |
| InChI | InChI=1S/C21H30ClNO4/c1-21(2,10-6-11-22)18(15-19(24)23-12-14-27-20(23)25)9-13-26-16-17-7-4-3-5-8-17/h3-5,7-8,18H,6,9-16H2,1-2H3 |
| InChIKey | XORJZEYOYDRLDS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|