C31H51NO4Si2 — CID 132500460
3-[(1S,2S)-4-[bis[tert-butyl(dimethyl)silyl]methyl]-2-(phenylmethoxymethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 132500460) has the molecular formula C31H51NO4Si2 and a molecular weight of 557.92 g/mol. Its IUPAC name is 3-[(1S,2S)-4-[bis[tert-butyl(dimethyl)silyl]methyl]-2-(phenylmethoxymethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1S,2S)-4-[bis[tert-butyl(dimethyl)silyl]methyl]-2-(phenylmethoxymethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132500460 |
| Molecular Formula | C31H51NO4Si2 |
| Molecular Weight | 557.92 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | 3-[(1S,2S)-4-[bis[tert-butyl(dimethyl)silyl]methyl]-2-(phenylmethoxymethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)C(C1=C[C@H](COCc2ccccc2)[C@@H](C(=O)N2CCOC2=O)CC1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H51NO4Si2/c1-30(2,3)37(7,8)28(38(9,10)31(4,5)6)24-16-17-26(27(33)32-18-19-36-29(32)34)25(20-24)22-35-21-23-14-12-11-13-15-23/h11-15,20,25-26,28H,16-19,21-22H2,1-10H3/t25-,26+/m1/s1 |
| InChIKey | HZJLATDPIQVIAO-FTJBHMTQSA-N |
| XLogP | 8.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.92 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|