C28H34N2O4 — CID 118212030
tert-butyl 3-[[3-[(4-methoxycarbonylphenyl)methyl]-2-methylindol-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 118212030) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is tert-butyl 3-[[3-[(4-methoxycarbonylphenyl)methyl]-2-methylindol-1-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-[(4-methoxycarbonylphenyl)methyl]-2-methylindol-1-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118212030 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | tert-butyl 3-[[3-[(4-methoxycarbonylphenyl)methyl]-2-methylindol-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(Cc2c(C)n(CC3CCN(C(=O)OC(C)(C)C)C3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H34N2O4/c1-19-24(16-20-10-12-22(13-11-20)26(31)33-5)23-8-6-7-9-25(23)30(19)18-21-14-15-29(17-21)27(32)34-28(2,3)4/h6-13,21H,14-18H2,1-5H3 |
| InChIKey | HHTPCOOBKKAHOI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|