C30H39FN2O2 — CID 118211818
methyl 4-[[1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-2-propylindol-3-yl]methyl]benzoate (PubChem CID 118211818) has the molecular formula C30H39FN2O2 and a molecular weight of 478.65 g/mol. Its IUPAC name is methyl 4-[[1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-2-propylindol-3-yl]methyl]benzoate.
| Compound Name | methyl 4-[[1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-2-propylindol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 118211818 |
| Molecular Formula | C30H39FN2O2 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | methyl 4-[[1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-2-propylindol-3-yl]methyl]benzoate |
| SMILES | CCCc1c(Cc2ccc(C(=O)OC)cc2)c2ccccc2n1CC1CCN(CC(C)(C)F)CC1 |
| InChI | InChI=1S/C30H39FN2O2/c1-5-8-27-26(19-22-11-13-24(14-12-22)29(34)35-4)25-9-6-7-10-28(25)33(27)20-23-15-17-32(18-16-23)21-30(2,3)31/h6-7,9-14,23H,5,8,15-21H2,1-4H3 |
| InChIKey | ASWAFORZVCGITK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|