C30H38N2O4 — CID 118212073
methyl 4-[[1-[[1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate (PubChem CID 118212073) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is methyl 4-[[1-[[1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate.
| Compound Name | methyl 4-[[1-[[1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 118212073 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | methyl 4-[[1-[[1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2c(C)n(CC3CCN(CC4(O)CCOCC4)CC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H38N2O4/c1-22-27(19-23-7-9-25(10-8-23)29(33)35-2)26-5-3-4-6-28(26)32(22)20-24-11-15-31(16-12-24)21-30(34)13-17-36-18-14-30/h3-10,24,34H,11-21H2,1-2H3 |
| InChIKey | KGVMOXUCBZNEMB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|