C24H27FIN2O2- — CID 148910139
methyl 4-[[1-[[3-(fluoromethyl)pyrrolidin-1-yl]iodanuidylmethyl]-2-methylindol-3-yl]methyl]benzoate (PubChem CID 148910139) has the molecular formula C24H27FIN2O2- and a molecular weight of 521.39 g/mol. Its IUPAC name is methyl 4-[[1-[[3-(fluoromethyl)pyrrolidin-1-yl]iodanuidylmethyl]-2-methylindol-3-yl]methyl]benzoate.
| Compound Name | methyl 4-[[1-[[3-(fluoromethyl)pyrrolidin-1-yl]iodanuidylmethyl]-2-methylindol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 148910139 |
| Molecular Formula | C24H27FIN2O2- |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | methyl 4-[[1-[[3-(fluoromethyl)pyrrolidin-1-yl]iodanuidylmethyl]-2-methylindol-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2c(C)n(C[I-]N3CCC(CF)C3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H27FIN2O2/c1-17-22(13-18-7-9-20(10-8-18)24(29)30-2)21-5-3-4-6-23(21)28(17)16-26-27-12-11-19(14-25)15-27/h3-10,19H,11-16H2,1-2H3/q-1 |
| InChIKey | ZBBJFTSEVGMFBQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|