C30H37FN2O3 — CID 118211927
methyl 4-[[1-[[1-[(4-fluorooxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate (PubChem CID 118211927) has the molecular formula C30H37FN2O3 and a molecular weight of 492.64 g/mol. Its IUPAC name is methyl 4-[[1-[[1-[(4-fluorooxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate.
| Compound Name | methyl 4-[[1-[[1-[(4-fluorooxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 118211927 |
| Molecular Formula | C30H37FN2O3 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | methyl 4-[[1-[[1-[(4-fluorooxan-4-yl)methyl]piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2c(C)n(CC3CCN(CC4(F)CCOCC4)CC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H37FN2O3/c1-22-27(19-23-7-9-25(10-8-23)29(34)35-2)26-5-3-4-6-28(26)33(22)20-24-11-15-32(16-12-24)21-30(31)13-17-36-18-14-30/h3-10,24H,11-21H2,1-2H3 |
| InChIKey | VHAVUAPMZUMDBF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|