C28H35N3O3 — CID 118211597
N-hydroxy-4-[[2-methyl-1-[[1-[(3-methyloxetan-3-yl)methyl]piperidin-4-yl]methyl]indol-3-yl]methyl]benzamide (PubChem CID 118211597) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-hydroxy-4-[[2-methyl-1-[[1-[(3-methyloxetan-3-yl)methyl]piperidin-4-yl]methyl]indol-3-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[2-methyl-1-[[1-[(3-methyloxetan-3-yl)methyl]piperidin-4-yl]methyl]indol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 118211597 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | N-hydroxy-4-[[2-methyl-1-[[1-[(3-methyloxetan-3-yl)methyl]piperidin-4-yl]methyl]indol-3-yl]methyl]benzamide |
| SMILES | Cc1c(Cc2ccc(C(=O)NO)cc2)c2ccccc2n1CC1CCN(CC2(C)COC2)CC1 |
| InChI | InChI=1S/C28H35N3O3/c1-20-25(15-21-7-9-23(10-8-21)27(32)29-33)24-5-3-4-6-26(24)31(20)16-22-11-13-30(14-12-22)17-28(2)18-34-19-28/h3-10,22,33H,11-19H2,1-2H3,(H,29,32) |
| InChIKey | GXHKADGUDASNGH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|