C24H27F2N3O2 — CID 118211667
4-[[5-fluoro-1-[2-(4-fluoropiperidin-1-yl)ethyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide (PubChem CID 118211667) has the molecular formula C24H27F2N3O2 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-[[5-fluoro-1-[2-(4-fluoropiperidin-1-yl)ethyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[5-fluoro-1-[2-(4-fluoropiperidin-1-yl)ethyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 118211667 |
| Molecular Formula | C24H27F2N3O2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-[[5-fluoro-1-[2-(4-fluoropiperidin-1-yl)ethyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide |
| SMILES | Cc1c(Cc2ccc(C(=O)NO)cc2)c2cc(F)ccc2n1CCN1CCC(F)CC1 |
| InChI | InChI=1S/C24H27F2N3O2/c1-16-21(14-17-2-4-18(5-3-17)24(30)27-31)22-15-20(26)6-7-23(22)29(16)13-12-28-10-8-19(25)9-11-28/h2-7,15,19,31H,8-14H2,1H3,(H,27,30) |
| InChIKey | MCZWWOQBCBEGDA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|