C20H19F2N3O2 — CID 71585548
4-[(7,9-difluoro-2-methyl-3,4-dihydro-1H-pyrimido[1,6-a]indol-5-yl)methyl]-N-hydroxybenzamide (PubChem CID 71585548) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[(7,9-difluoro-2-methyl-3,4-dihydro-1H-pyrimido[1,6-a]indol-5-yl)methyl]-N-hydroxybenzamide.
| Compound Name | 4-[(7,9-difluoro-2-methyl-3,4-dihydro-1H-pyrimido[1,6-a]indol-5-yl)methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 71585548 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-[(7,9-difluoro-2-methyl-3,4-dihydro-1H-pyrimido[1,6-a]indol-5-yl)methyl]-N-hydroxybenzamide |
| SMILES | CN1CCc2c(Cc3ccc(C(=O)NO)cc3)c3cc(F)cc(F)c3n2C1 |
| InChI | InChI=1S/C20H19F2N3O2/c1-24-7-6-18-15(8-12-2-4-13(5-3-12)20(26)23-27)16-9-14(21)10-17(22)19(16)25(18)11-24/h2-5,9-10,27H,6-8,11H2,1H3,(H,23,26) |
| InChIKey | GUNPKRHQCCJCMD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|