C28H37FN4O2 — CID 118212106
4-[[1-[3-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]propyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide (PubChem CID 118212106) has the molecular formula C28H37FN4O2 and a molecular weight of 480.63 g/mol. Its IUPAC name is 4-[[1-[3-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]propyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[1-[3-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]propyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 118212106 |
| Molecular Formula | C28H37FN4O2 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | 4-[[1-[3-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]propyl]-2-methylindol-3-yl]methyl]-N-hydroxybenzamide |
| SMILES | Cc1c(Cc2ccc(C(=O)NO)cc2)c2ccccc2n1CCCN1CCN(CC(C)(C)F)CC1 |
| InChI | InChI=1S/C28H37FN4O2/c1-21-25(19-22-9-11-23(12-10-22)27(34)30-35)24-7-4-5-8-26(24)33(21)14-6-13-31-15-17-32(18-16-31)20-28(2,3)29/h4-5,7-12,35H,6,13-20H2,1-3H3,(H,30,34) |
| InChIKey | HSKFTXDGEOIWFB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|