C29H41FN4O2 — CID 162335155
4-[[1-[4-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]butyl]-2-methylindol-3-yl]methyl]benzamide;hydrate (PubChem CID 162335155) has the molecular formula C29H41FN4O2 and a molecular weight of 496.67 g/mol. Its IUPAC name is 4-[[1-[4-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]butyl]-2-methylindol-3-yl]methyl]benzamide;hydrate.
| Compound Name | 4-[[1-[4-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]butyl]-2-methylindol-3-yl]methyl]benzamide;hydrate |
|---|---|
| PubChem CID | 162335155 |
| Molecular Formula | C29H41FN4O2 |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 4-[[1-[4-[4-(2-fluoro-2-methylpropyl)piperazin-1-yl]butyl]-2-methylindol-3-yl]methyl]benzamide;hydrate |
| SMILES | Cc1c(Cc2ccc(C(N)=O)cc2)c2ccccc2n1CCCCN1CCN(CC(C)(C)F)CC1.O |
| InChI | InChI=1S/C29H39FN4O.H2O/c1-22-26(20-23-10-12-24(13-11-23)28(31)35)25-8-4-5-9-27(25)34(22)15-7-6-14-32-16-18-33(19-17-32)21-29(2,3)30;/h4-5,8-13H,6-7,14-21H2,1-3H3,(H2,31,35);1H2 |
| InChIKey | IERINQBXJMCLSY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|