C19H15ClFN3O3S — CID 71585346
4-[(8-chloro-6-fluoro-2-methyl-1-oxo-3,4-dihydropyrazino[1,2-a]indol-10-yl)sulfanyl]-N-hydroxybenzamide (PubChem CID 71585346) has the molecular formula C19H15ClFN3O3S and a molecular weight of 419.87 g/mol. Its IUPAC name is 4-[(8-chloro-6-fluoro-2-methyl-1-oxo-3,4-dihydropyrazino[1,2-a]indol-10-yl)sulfanyl]-N-hydroxybenzamide.
| Compound Name | 4-[(8-chloro-6-fluoro-2-methyl-1-oxo-3,4-dihydropyrazino[1,2-a]indol-10-yl)sulfanyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 71585346 |
| Molecular Formula | C19H15ClFN3O3S |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 4-[(8-chloro-6-fluoro-2-methyl-1-oxo-3,4-dihydropyrazino[1,2-a]indol-10-yl)sulfanyl]-N-hydroxybenzamide |
| SMILES | CN1CCn2c(c(Sc3ccc(C(=O)NO)cc3)c3cc(Cl)cc(F)c32)C1=O |
| InChI | InChI=1S/C19H15ClFN3O3S/c1-23-6-7-24-15-13(8-11(20)9-14(15)21)17(16(24)19(23)26)28-12-4-2-10(3-5-12)18(25)22-27/h2-5,8-9,27H,6-7H2,1H3,(H,22,25) |
| InChIKey | COALSBOYMKRDGE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|