C15H9ClF3NO3S — CID 45341431
4-chloro-2-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoic acid (PubChem CID 45341431) has the molecular formula C15H9ClF3NO3S and a molecular weight of 375.76 g/mol. Its IUPAC name is 4-chloro-2-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 45341431 |
| Molecular Formula | C15H9ClF3NO3S |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 4-chloro-2-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1C(=O)O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H9ClF3NO3S/c16-9-3-6-11(14(22)23)12(7-9)20-13(21)8-1-4-10(5-2-8)24-15(17,18)19/h1-7H,(H,20,21)(H,22,23) |
| InChIKey | JTXWMLGNYQSZPC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |