C26H27FN4O5 — CID 123930706
4-[[6-fluoro-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-3-yl]methyl]piperazine-1-carboxylic acid (PubChem CID 123930706) has the molecular formula C26H27FN4O5 and a molecular weight of 494.52 g/mol. Its IUPAC name is 4-[[6-fluoro-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-3-yl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[6-fluoro-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-3-yl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 123930706 |
| Molecular Formula | C26H27FN4O5 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-[[6-fluoro-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-3-yl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(NO)c1ccc(Cn2c3c(c4cc(F)ccc42)C(=O)C(CN2CCN(C(=O)O)CC2)CC3)cc1 |
| InChI | InChI=1S/C26H27FN4O5/c27-19-6-8-21-20(13-19)23-22(31(21)14-16-1-3-17(4-2-16)25(33)28-36)7-5-18(24(23)32)15-29-9-11-30(12-10-29)26(34)35/h1-4,6,8,13,18,36H,5,7,9-12,14-15H2,(H,28,33)(H,34,35) |
| InChIKey | DVQCOIVZTZWDMI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|