C27H30FN5O4 — CID 123289591
4-[[8-fluoro-2-[2-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl]methyl]-N-nitrosobenzamide (PubChem CID 123289591) has the molecular formula C27H30FN5O4 and a molecular weight of 507.57 g/mol. Its IUPAC name is 4-[[8-fluoro-2-[2-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl]methyl]-N-nitrosobenzamide.
| Compound Name | 4-[[8-fluoro-2-[2-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl]methyl]-N-nitrosobenzamide |
|---|---|
| PubChem CID | 123289591 |
| Molecular Formula | C27H30FN5O4 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 4-[[8-fluoro-2-[2-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl]methyl]-N-nitrosobenzamide |
| SMILES | COCC1CCCN1CCN1CCc2c(c3cc(F)ccc3n2Cc2ccc(C(=O)NN=O)cc2)C1=O |
| InChI | InChI=1S/C27H30FN5O4/c1-37-17-21-3-2-11-31(21)13-14-32-12-10-24-25(27(32)35)22-15-20(28)8-9-23(22)33(24)16-18-4-6-19(7-5-18)26(34)29-30-36/h4-9,15,21H,2-3,10-14,16-17H2,1H3,(H,29,34,36) |
| InChIKey | BVEJMPMSBLJADI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|