C29H37FN2O3 — CID 118211671
ethyl 3-fluoro-4-[[1-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate (PubChem CID 118211671) has the molecular formula C29H37FN2O3 and a molecular weight of 480.62 g/mol. Its IUPAC name is ethyl 3-fluoro-4-[[1-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate.
| Compound Name | ethyl 3-fluoro-4-[[1-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 118211671 |
| Molecular Formula | C29H37FN2O3 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | ethyl 3-fluoro-4-[[1-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]-2-methylindol-3-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(Cc2c(C)n(CC3CCN(CC(C)(C)O)CC3)c3ccccc23)c(F)c1 |
| InChI | InChI=1S/C29H37FN2O3/c1-5-35-28(33)23-11-10-22(26(30)17-23)16-25-20(2)32(27-9-7-6-8-24(25)27)18-21-12-14-31(15-13-21)19-29(3,4)34/h6-11,17,21,34H,5,12-16,18-19H2,1-4H3 |
| InChIKey | JNJKFGQGKQAUSY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|