C26H33ClN2O2 — CID 140753891
4-[[2-butyl-1-(piperidin-4-ylmethyl)indol-3-yl]methyl]benzoic acid;hydrochloride (PubChem CID 140753891) has the molecular formula C26H33ClN2O2 and a molecular weight of 441.02 g/mol. Its IUPAC name is 4-[[2-butyl-1-(piperidin-4-ylmethyl)indol-3-yl]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[2-butyl-1-(piperidin-4-ylmethyl)indol-3-yl]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 140753891 |
| Molecular Formula | C26H33ClN2O2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 4-[[2-butyl-1-(piperidin-4-ylmethyl)indol-3-yl]methyl]benzoic acid;hydrochloride |
| SMILES | CCCCc1c(Cc2ccc(C(=O)O)cc2)c2ccccc2n1CC1CCNCC1.Cl |
| InChI | InChI=1S/C26H32N2O2.ClH/c1-2-3-7-25-23(17-19-9-11-21(12-10-19)26(29)30)22-6-4-5-8-24(22)28(25)18-20-13-15-27-16-14-20;/h4-6,8-12,20,27H,2-3,7,13-18H2,1H3,(H,29,30);1H |
| InChIKey | AZUMSLVMBIYVQL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|