C37H44N2O4 — CID 175636354
2-[3-[[6-[(3-butylphenyl)methylcarbamoyl]-1-(cyclobutylmethyl)-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 175636354) has the molecular formula C37H44N2O4 and a molecular weight of 580.77 g/mol. Its IUPAC name is 2-[3-[[6-[(3-butylphenyl)methylcarbamoyl]-1-(cyclobutylmethyl)-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[[6-[(3-butylphenyl)methylcarbamoyl]-1-(cyclobutylmethyl)-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175636354 |
| Molecular Formula | C37H44N2O4 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 2-[3-[[6-[(3-butylphenyl)methylcarbamoyl]-1-(cyclobutylmethyl)-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCc1cccc(CNC(=O)c2ccc3c(Cc4cccc(OC(C)(C)C(=O)O)c4)c(C)n(CC4CCC4)c3c2)c1 |
| InChI | InChI=1S/C37H44N2O4/c1-5-6-10-26-11-7-15-29(19-26)23-38-35(40)30-17-18-32-33(25(2)39(34(32)22-30)24-27-12-8-13-27)21-28-14-9-16-31(20-28)43-37(3,4)36(41)42/h7,9,11,14-20,22,27H,5-6,8,10,12-13,21,23-24H2,1-4H3,(H,38,40)(H,41,42) |
| InChIKey | QQQGXZAYJXZVNO-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|