C35H42N2O4 — CID 171845795
ethyl 2-[3-[[6-[[(1S)-1-(4-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]propanoate (PubChem CID 171845795) has the molecular formula C35H42N2O4 and a molecular weight of 554.73 g/mol. Its IUPAC name is ethyl 2-[3-[[6-[[(1S)-1-(4-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]propanoate.
| Compound Name | ethyl 2-[3-[[6-[[(1S)-1-(4-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 171845795 |
| Molecular Formula | C35H42N2O4 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | ethyl 2-[3-[[6-[[(1S)-1-(4-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]propanoate |
| SMILES | CCCCc1ccc([C@H](C)NC(=O)c2ccc3c(Cc4cccc(OC(C)C(=O)OCC)c4)c(C)n(C)c3c2)cc1 |
| InChI | InChI=1S/C35H42N2O4/c1-7-9-11-26-14-16-28(17-15-26)23(3)36-34(38)29-18-19-31-32(24(4)37(6)33(31)22-29)21-27-12-10-13-30(20-27)41-25(5)35(39)40-8-2/h10,12-20,22-23,25H,7-9,11,21H2,1-6H3,(H,36,38)/t23-,25?/m0/s1 |
| InChIKey | OOJNGWAZFWLVJO-LFQPHHBNSA-N |
| XLogP | 7.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|