C31H38N2O2 — CID 171845773
N-[(1S)-1-(3-butylphenyl)ethyl]-3-[(2Z,4E)-2-ethenyl-4-hydroxyhexa-2,4-dienyl]-1,2-dimethylindole-6-carboxamide (PubChem CID 171845773) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is N-[(1S)-1-(3-butylphenyl)ethyl]-3-[(2Z,4E)-2-ethenyl-4-hydroxyhexa-2,4-dienyl]-1,2-dimethylindole-6-carboxamide.
| Compound Name | N-[(1S)-1-(3-butylphenyl)ethyl]-3-[(2Z,4E)-2-ethenyl-4-hydroxyhexa-2,4-dienyl]-1,2-dimethylindole-6-carboxamide |
|---|---|
| PubChem CID | 171845773 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | N-[(1S)-1-(3-butylphenyl)ethyl]-3-[(2Z,4E)-2-ethenyl-4-hydroxyhexa-2,4-dienyl]-1,2-dimethylindole-6-carboxamide |
| SMILES | C=C/C(=C\C(O)=C/C)Cc1c(C)n(C)c2cc(C(=O)N[C@@H](C)c3cccc(CCCC)c3)ccc12 |
| InChI | InChI=1S/C31H38N2O2/c1-7-10-12-24-13-11-14-25(17-24)21(4)32-31(35)26-15-16-28-29(22(5)33(6)30(28)20-26)19-23(8-2)18-27(34)9-3/h8-9,11,13-18,20-21,34H,2,7,10,12,19H2,1,3-6H3,(H,32,35)/b23-18+,27-9+/t21-/m0/s1 |
| InChIKey | PAJIVAWMKYTDOH-IFSZQNBOSA-N |
| XLogP | 7.44 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|