C34H40N2O4 — CID 171845514
2-[4-[[6-[[(1S)-1-(3-tert-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 171845514) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is 2-[4-[[6-[[(1S)-1-(3-tert-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[6-[[(1S)-1-(3-tert-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 171845514 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 2-[4-[[6-[[(1S)-1-(3-tert-butylphenyl)ethyl]carbamoyl]-1,2-dimethylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | Cc1c(Cc2ccc(OC(C)(C)C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)c3cccc(C(C)(C)C)c3)cc2n1C |
| InChI | InChI=1S/C34H40N2O4/c1-21(24-10-9-11-26(19-24)33(3,4)5)35-31(37)25-14-17-28-29(22(2)36(8)30(28)20-25)18-23-12-15-27(16-13-23)40-34(6,7)32(38)39/h9-17,19-21H,18H2,1-8H3,(H,35,37)(H,38,39)/t21-/m0/s1 |
| InChIKey | IZZOTHLELHCREL-NRFANRHFSA-N |
| XLogP | 7.11 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|