C32H33F3N2O4 — CID 171845510
ethyl 2-[4-[[1,2-dimethyl-6-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-3-yl]methyl]phenoxy]propanoate (PubChem CID 171845510) has the molecular formula C32H33F3N2O4 and a molecular weight of 566.62 g/mol. Its IUPAC name is ethyl 2-[4-[[1,2-dimethyl-6-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-3-yl]methyl]phenoxy]propanoate.
| Compound Name | ethyl 2-[4-[[1,2-dimethyl-6-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-3-yl]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 171845510 |
| Molecular Formula | C32H33F3N2O4 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | ethyl 2-[4-[[1,2-dimethyl-6-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-3-yl]methyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc(Cc2c(C)n(C)c3cc(C(=O)N[C@@H](C)c4ccc(C(F)(F)F)cc4)ccc23)cc1 |
| InChI | InChI=1S/C32H33F3N2O4/c1-6-40-31(39)21(4)41-26-14-7-22(8-15-26)17-28-20(3)37(5)29-18-24(11-16-27(28)29)30(38)36-19(2)23-9-12-25(13-10-23)32(33,34)35/h7-16,18-19,21H,6,17H2,1-5H3,(H,36,38)/t19-,21?/m0/s1 |
| InChIKey | XTYINXHQIIFAFR-ZQRQZVKFSA-N |
| XLogP | 6.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|