C30H33ClN2O2 — CID 171845438
N-[(1S)-1-(4-tert-butylphenyl)ethyl]-3-[(2-chloro-3-hydroxyphenyl)methyl]-1,2-dimethylindole-6-carboxamide (PubChem CID 171845438) has the molecular formula C30H33ClN2O2 and a molecular weight of 489.06 g/mol. Its IUPAC name is N-[(1S)-1-(4-tert-butylphenyl)ethyl]-3-[(2-chloro-3-hydroxyphenyl)methyl]-1,2-dimethylindole-6-carboxamide.
| Compound Name | N-[(1S)-1-(4-tert-butylphenyl)ethyl]-3-[(2-chloro-3-hydroxyphenyl)methyl]-1,2-dimethylindole-6-carboxamide |
|---|---|
| PubChem CID | 171845438 |
| Molecular Formula | C30H33ClN2O2 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[(1S)-1-(4-tert-butylphenyl)ethyl]-3-[(2-chloro-3-hydroxyphenyl)methyl]-1,2-dimethylindole-6-carboxamide |
| SMILES | Cc1c(Cc2cccc(O)c2Cl)c2ccc(C(=O)N[C@@H](C)c3ccc(C(C)(C)C)cc3)cc2n1C |
| InChI | InChI=1S/C30H33ClN2O2/c1-18(20-10-13-23(14-11-20)30(3,4)5)32-29(35)22-12-15-24-25(19(2)33(6)26(24)17-22)16-21-8-7-9-27(34)28(21)31/h7-15,17-18,34H,16H2,1-6H3,(H,32,35)/t18-/m0/s1 |
| InChIKey | QAUXFUBXSVBFAH-SFHVURJKSA-N |
| XLogP | 7.23 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|