C21H20N2O3 — CID 118212779
ethyl 5-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-3-carboxylate (PubChem CID 118212779) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl 5-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118212779 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | ethyl 5-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(Cc2ccc(Cc3ccc[nH]c3=O)cc2)c1 |
| InChI | InChI=1S/C21H20N2O3/c1-2-26-21(25)19-12-17(13-22-14-19)10-15-5-7-16(8-6-15)11-18-4-3-9-23-20(18)24/h3-9,12-14H,2,10-11H2,1H3,(H,23,24) |
| InChIKey | AIGOSTHLUFKVMO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |