C19H18N2O4 — CID 110457899
ethyl 5-[(2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]pyridine-3-carboxylate (PubChem CID 110457899) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 5-[(2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[(2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 110457899 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl 5-[(2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(CC2CC(=O)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-2-25-19(24)15-9-13(11-20-12-15)8-14-10-17(22)21(18(14)23)16-6-4-3-5-7-16/h3-7,9,11-12,14H,2,8,10H2,1H3 |
| InChIKey | MVJZSOAVYMFLOK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|