C20H19NO4 — CID 822196
4-[(3R)-3-[(3,5-dimethylphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 822196) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[(3R)-3-[(3,5-dimethylphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[(3R)-3-[(3,5-dimethylphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 822196 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-[(3R)-3-[(3,5-dimethylphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | Cc1cc(C)cc(C[C@@H]2CC(=O)N(c3ccc(C(=O)O)cc3)C2=O)c1 |
| InChI | InChI=1S/C20H19NO4/c1-12-7-13(2)9-14(8-12)10-16-11-18(22)21(19(16)23)17-5-3-15(4-6-17)20(24)25/h3-9,16H,10-11H2,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | BCRUUYFLEJKVJU-MRXNPFEDSA-N |
| XLogP | 3.12 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|