C14H17FN2O4 — CID 118213844
methyl (3R)-3-[3-fluoro-4-(methylcarbamoyl)anilino]oxolane-3-carboxylate (PubChem CID 118213844) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is methyl (3R)-3-[3-fluoro-4-(methylcarbamoyl)anilino]oxolane-3-carboxylate.
| Compound Name | methyl (3R)-3-[3-fluoro-4-(methylcarbamoyl)anilino]oxolane-3-carboxylate |
|---|---|
| PubChem CID | 118213844 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl (3R)-3-[3-fluoro-4-(methylcarbamoyl)anilino]oxolane-3-carboxylate |
| SMILES | CNC(=O)c1ccc(N[C@]2(C(=O)OC)CCOC2)cc1F |
| InChI | InChI=1S/C14H17FN2O4/c1-16-12(18)10-4-3-9(7-11(10)15)17-14(13(19)20-2)5-6-21-8-14/h3-4,7,17H,5-6,8H2,1-2H3,(H,16,18)/t14-/m1/s1 |
| InChIKey | LLOXPTDOECLEOD-CQSZACIVSA-N |
| XLogP | 0.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |