C12H15FN2O2 — CID 88957064
2-fluoro-N-methyl-4-[(2-methyl-1-oxopropan-2-yl)amino]benzamide (PubChem CID 88957064) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-fluoro-N-methyl-4-[(2-methyl-1-oxopropan-2-yl)amino]benzamide.
| Compound Name | 2-fluoro-N-methyl-4-[(2-methyl-1-oxopropan-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 88957064 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-fluoro-N-methyl-4-[(2-methyl-1-oxopropan-2-yl)amino]benzamide |
| SMILES | CNC(=O)c1ccc(NC(C)(C)C=O)cc1F |
| InChI | InChI=1S/C12H15FN2O2/c1-12(2,7-16)15-8-4-5-9(10(13)6-8)11(17)14-3/h4-7,15H,1-3H3,(H,14,17) |
| InChIKey | XAUFAUIVIBPSCI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|