C13H14FN2O2Y- — CID 153370073
2-fluoro-N-methyl-4-[[1-(oxomethyl)cyclobutyl]amino]benzamide;yttrium (PubChem CID 153370073) has the molecular formula C13H14FN2O2Y- and a molecular weight of 338.17 g/mol. Its IUPAC name is 2-fluoro-N-methyl-4-[[1-(oxomethyl)cyclobutyl]amino]benzamide;yttrium.
| Compound Name | 2-fluoro-N-methyl-4-[[1-(oxomethyl)cyclobutyl]amino]benzamide;yttrium |
|---|---|
| PubChem CID | 153370073 |
| Molecular Formula | C13H14FN2O2Y- |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-fluoro-N-methyl-4-[[1-(oxomethyl)cyclobutyl]amino]benzamide;yttrium |
| SMILES | CNC(=O)c1ccc(NC2([C-]=O)CCC2)cc1F.[Y] |
| InChI | InChI=1S/C13H14FN2O2.Y/c1-15-12(18)10-4-3-9(7-11(10)14)16-13(8-17)5-2-6-13;/h3-4,7,16H,2,5-6H2,1H3,(H,15,18);/q-1; |
| InChIKey | VSJXEZIIAWNNIS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|