C18H22O2 — CID 11821691
(1R,5R,10S)-5-methyl-10-phenylmethoxybicyclo[4.3.1]dec-6-en-2-one (PubChem CID 11821691) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,5R,10S)-5-methyl-10-phenylmethoxybicyclo[4.3.1]dec-6-en-2-one.
| Compound Name | (1R,5R,10S)-5-methyl-10-phenylmethoxybicyclo[4.3.1]dec-6-en-2-one |
|---|---|
| PubChem CID | 11821691 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1R,5R,10S)-5-methyl-10-phenylmethoxybicyclo[4.3.1]dec-6-en-2-one |
| SMILES | C[C@@H]1CCC(=O)[C@@H]2CCC=C1[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C18H22O2/c1-13-10-11-17(19)16-9-5-8-15(13)18(16)20-12-14-6-3-2-4-7-14/h2-4,6-8,13,16,18H,5,9-12H2,1H3/t13-,16+,18-/m1/s1 |
| InChIKey | PTCUAZUJGKXERU-RPVQJOFSSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|