C16H26N2S — CID 11821958
2-(benzylamino)-N-tert-butyl-3-methylbutanethioamide (PubChem CID 11821958) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 2-(benzylamino)-N-tert-butyl-3-methylbutanethioamide.
| Compound Name | 2-(benzylamino)-N-tert-butyl-3-methylbutanethioamide |
|---|---|
| PubChem CID | 11821958 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-(benzylamino)-N-tert-butyl-3-methylbutanethioamide |
| SMILES | CC(C)C(NCc1ccccc1)C(=S)NC(C)(C)C |
| InChI | InChI=1S/C16H26N2S/c1-12(2)14(15(19)18-16(3,4)5)17-11-13-9-7-6-8-10-13/h6-10,12,14,17H,11H2,1-5H3,(H,18,19) |
| InChIKey | OJUQRCHMMLNGDK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|