C15H24OSSi — CID 11822038
2,2-dimethyl-3-[phenyl(trimethylsilyl)methyl]sulfanylpropanal (PubChem CID 11822038) has the molecular formula C15H24OSSi and a molecular weight of 280.51 g/mol. Its IUPAC name is 2,2-dimethyl-3-[phenyl(trimethylsilyl)methyl]sulfanylpropanal.
| Compound Name | 2,2-dimethyl-3-[phenyl(trimethylsilyl)methyl]sulfanylpropanal |
|---|---|
| PubChem CID | 11822038 |
| Molecular Formula | C15H24OSSi |
| Molecular Weight | 280.51 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2,2-dimethyl-3-[phenyl(trimethylsilyl)methyl]sulfanylpropanal |
| SMILES | CC(C)(C=O)CSC(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H24OSSi/c1-15(2,11-16)12-17-14(18(3,4)5)13-9-7-6-8-10-13/h6-11,14H,12H2,1-5H3 |
| InChIKey | CFCHGTMISFEOGU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|