C15H24O5 — CID 11822172
(4'aS,6'S,7'R,8'aR)-6',7'-dihydroxy-5,5-dimethylspiro[1,3-dioxane-2,4'-2,3,4a,5,6,7,8,8a-octahydronaphthalene]-1'-one (PubChem CID 11822172) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (4'aS,6'S,7'R,8'aR)-6',7'-dihydroxy-5,5-dimethylspiro[1,3-dioxane-2,4'-2,3,4a,5,6,7,8,8a-octahydronaphthalene]-1'-one.
| Compound Name | (4'aS,6'S,7'R,8'aR)-6',7'-dihydroxy-5,5-dimethylspiro[1,3-dioxane-2,4'-2,3,4a,5,6,7,8,8a-octahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 11822172 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4'aS,6'S,7'R,8'aR)-6',7'-dihydroxy-5,5-dimethylspiro[1,3-dioxane-2,4'-2,3,4a,5,6,7,8,8a-octahydronaphthalene]-1'-one |
| SMILES | CC1(C)COC2(CCC(=O)[C@@H]3C[C@@H](O)[C@@H](O)C[C@@H]32)OC1 |
| InChI | InChI=1S/C15H24O5/c1-14(2)7-19-15(20-8-14)4-3-11(16)9-5-12(17)13(18)6-10(9)15/h9-10,12-13,17-18H,3-8H2,1-2H3/t9-,10+,12-,13+/m1/s1 |
| InChIKey | HSQWRIVTEWTSPT-DNIRFERGSA-N |
| XLogP | 0.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |