C18H28O5 — CID 11012772
(3'aS,4'aS,8'aS,9'aR)-2',2',5,5-tetramethylspiro[1,3-dioxane-2,5'-3a,4,4a,6,7,8a,9,9a-octahydronaphtho[6,7-d][1,3]dioxole]-8'-one (PubChem CID 11012772) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3'aS,4'aS,8'aS,9'aR)-2',2',5,5-tetramethylspiro[1,3-dioxane-2,5'-3a,4,4a,6,7,8a,9,9a-octahydronaphtho[6,7-d][1,3]dioxole]-8'-one.
| Compound Name | (3'aS,4'aS,8'aS,9'aR)-2',2',5,5-tetramethylspiro[1,3-dioxane-2,5'-3a,4,4a,6,7,8a,9,9a-octahydronaphtho[6,7-d][1,3]dioxole]-8'-one |
|---|---|
| PubChem CID | 11012772 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (3'aS,4'aS,8'aS,9'aR)-2',2',5,5-tetramethylspiro[1,3-dioxane-2,5'-3a,4,4a,6,7,8a,9,9a-octahydronaphtho[6,7-d][1,3]dioxole]-8'-one |
| SMILES | CC1(C)COC2(CCC(=O)[C@H]3C[C@H]4OC(C)(C)O[C@H]4C[C@@H]32)OC1 |
| InChI | InChI=1S/C18H28O5/c1-16(2)9-20-18(21-10-16)6-5-13(19)11-7-14-15(8-12(11)18)23-17(3,4)22-14/h11-12,14-15H,5-10H2,1-4H3/t11-,12-,14+,15-/m0/s1 |
| InChIKey | NFHQJJLMLBAKJU-VIRABCJISA-N |
| XLogP | 2.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |