C16H26O5 — CID 11403784
(3aR,4R,5aS,9aR,9bR)-4-hydroxy-4-[(1S)-1-methoxyethyl]-2,2-dimethyl-3a,5,5a,7,8,9,9a,9b-octahydronaphtho[1,2-d][1,3]dioxol-6-one (PubChem CID 11403784) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3aR,4R,5aS,9aR,9bR)-4-hydroxy-4-[(1S)-1-methoxyethyl]-2,2-dimethyl-3a,5,5a,7,8,9,9a,9b-octahydronaphtho[1,2-d][1,3]dioxol-6-one.
| Compound Name | (3aR,4R,5aS,9aR,9bR)-4-hydroxy-4-[(1S)-1-methoxyethyl]-2,2-dimethyl-3a,5,5a,7,8,9,9a,9b-octahydronaphtho[1,2-d][1,3]dioxol-6-one |
|---|---|
| PubChem CID | 11403784 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3aR,4R,5aS,9aR,9bR)-4-hydroxy-4-[(1S)-1-methoxyethyl]-2,2-dimethyl-3a,5,5a,7,8,9,9a,9b-octahydronaphtho[1,2-d][1,3]dioxol-6-one |
| SMILES | CO[C@@H](C)[C@]1(O)C[C@@H]2C(=O)CCC[C@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H26O5/c1-9(19-4)16(18)8-11-10(6-5-7-12(11)17)13-14(16)21-15(2,3)20-13/h9-11,13-14,18H,5-8H2,1-4H3/t9-,10+,11-,13+,14+,16+/m0/s1 |
| InChIKey | QUWZFBSASNLISV-RHRFOWRNSA-N |
| XLogP | 1.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |