C18H28O5 — CID 11034686
[(3aR,4R,5aR,6S,9aS,9bS)-2,2,4,5a,9,9-hexamethyl-5-oxo-4,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-6-yl] formate (PubChem CID 11034686) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(3aR,4R,5aR,6S,9aS,9bS)-2,2,4,5a,9,9-hexamethyl-5-oxo-4,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-6-yl] formate.
| Compound Name | [(3aR,4R,5aR,6S,9aS,9bS)-2,2,4,5a,9,9-hexamethyl-5-oxo-4,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-6-yl] formate |
|---|---|
| PubChem CID | 11034686 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [(3aR,4R,5aR,6S,9aS,9bS)-2,2,4,5a,9,9-hexamethyl-5-oxo-4,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-6-yl] formate |
| SMILES | C[C@H]1C(=O)[C@@]2(C)[C@@H](OC=O)CCC(C)(C)[C@@H]2[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H28O5/c1-10-12-13(23-17(4,5)22-12)14-16(2,3)8-7-11(21-9-19)18(14,6)15(10)20/h9-14H,7-8H2,1-6H3/t10-,11+,12-,13-,14+,18+/m1/s1 |
| InChIKey | LNXQYQUKZRSCGR-BUBPUTBESA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|