C17H28O4 — CID 134946014
(2R,10R)-2-ethoxy-10-(hydroxymethyl)-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one (PubChem CID 134946014) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R,10R)-2-ethoxy-10-(hydroxymethyl)-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one.
| Compound Name | (2R,10R)-2-ethoxy-10-(hydroxymethyl)-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one |
|---|---|
| PubChem CID | 134946014 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (2R,10R)-2-ethoxy-10-(hydroxymethyl)-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one |
| SMILES | CCO[C@H]1CC23C(CCC(C)C2(C)CCC(=O)[C@H]3CO)O1 |
| InChI | InChI=1S/C17H28O4/c1-4-20-15-9-17-12(10-18)13(19)7-8-16(17,3)11(2)5-6-14(17)21-15/h11-12,14-15,18H,4-10H2,1-3H3/t11?,12-,14?,15-,16?,17?/m1/s1 |
| InChIKey | ODTGKXINDIZWSV-JHHYLNLQSA-N |
| XLogP | 2.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |