C17H28O4 — CID 127054592
(1R,4aR,6S,8aS)-1-(1,3-dioxolan-2-ylmethyl)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 127054592) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1R,4aR,6S,8aS)-1-(1,3-dioxolan-2-ylmethyl)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aR,6S,8aS)-1-(1,3-dioxolan-2-ylmethyl)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 127054592 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (1R,4aR,6S,8aS)-1-(1,3-dioxolan-2-ylmethyl)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@@H](CC3OCCO3)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C17H28O4/c1-16(2)13-5-4-12(18)11(10-15-20-8-9-21-15)17(13,3)7-6-14(16)19/h11,13-15,19H,4-10H2,1-3H3/t11-,13-,14-,17+/m0/s1 |
| InChIKey | AOIYAQIMQDLZEB-PLNCSYRRSA-N |
| XLogP | 2.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |