C20H28O6 — CID 163193975
CID 163193975 (PubChem CID 163193975) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol.
| Compound Name | CID 163193975 |
|---|---|
| PubChem CID | 163193975 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H]2OC(=O)[C@@]3(C)C(=O)CC[C@@](C)([C@@H]23)[C@@]12CC[C@]1(CC[C@H](O)O1)O2 |
| InChI | InChI=1S/C20H28O6/c1-11-10-12-15-17(2,6-4-13(21)18(15,3)16(23)24-12)20(11)9-8-19(26-20)7-5-14(22)25-19/h11-12,14-15,22H,4-10H2,1-3H3/t11-,12-,14-,15-,17+,18+,19+,20-/m1/s1 |
| InChIKey | YIBHQGQRCRBQAM-RBWJHFQSSA-N |
| XLogP | 2.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|