C18H28O5 — CID 162415431
methyl (1'R,2'R,4'aR,5'R,8'aS)-2',5'-dimethyl-1'-(2-oxoethyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydronaphthalene]-1'-carboxylate (PubChem CID 162415431) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl (1'R,2'R,4'aR,5'R,8'aS)-2',5'-dimethyl-1'-(2-oxoethyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydronaphthalene]-1'-carboxylate.
| Compound Name | methyl (1'R,2'R,4'aR,5'R,8'aS)-2',5'-dimethyl-1'-(2-oxoethyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydronaphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 162415431 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | methyl (1'R,2'R,4'aR,5'R,8'aS)-2',5'-dimethyl-1'-(2-oxoethyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydronaphthalene]-1'-carboxylate |
| SMILES | COC(=O)[C@]1(CC=O)[C@H](C)CC[C@@H]2[C@H](C)CC3(C[C@@H]21)OCCO3 |
| InChI | InChI=1S/C18H28O5/c1-12-10-17(22-8-9-23-17)11-15-14(12)5-4-13(2)18(15,6-7-19)16(20)21-3/h7,12-15H,4-6,8-11H2,1-3H3/t12-,13-,14-,15+,18-/m1/s1 |
| InChIKey | NRIXQLYVNVLRFX-ZURLZEQWSA-N |
| XLogP | 2.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|