C17H26O5 — CID 134886704
ethyl (1'R,4'aR)-1',4'a-dimethyl-2'-oxospiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate (PubChem CID 134886704) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl (1'R,4'aR)-1',4'a-dimethyl-2'-oxospiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate.
| Compound Name | ethyl (1'R,4'aR)-1',4'a-dimethyl-2'-oxospiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 134886704 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | ethyl (1'R,4'aR)-1',4'a-dimethyl-2'-oxospiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C(=O)CC[C@]2(C)C1CCCC21OCCO1 |
| InChI | InChI=1S/C17H26O5/c1-4-20-14(19)16(3)12-6-5-8-17(21-10-11-22-17)15(12,2)9-7-13(16)18/h12H,4-11H2,1-3H3/t12?,15-,16-/m1/s1 |
| InChIKey | AYESPTWIJLHVFC-XHAYOOOLSA-N |
| XLogP | 2.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|