C15H24O3 — CID 132820480
(4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one (PubChem CID 132820480) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one.
| Compound Name | (4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
|---|---|
| PubChem CID | 132820480 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
| SMILES | CC1(C)C(=O)CC[C@@]2(C)C1CCCC21OCCO1 |
| InChI | InChI=1S/C15H24O3/c1-13(2)11-5-4-7-15(17-9-10-18-15)14(11,3)8-6-12(13)16/h11H,4-10H2,1-3H3/t11?,14-/m0/s1 |
| InChIKey | FUZOGFUMPFIVON-IAXJKZSUSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |