C14H20O4 — CID 162411064
(3aS,4aS,8aS,9aR)-4a,9,9-trimethyl-4,6,7,8,8a,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxole-2,5-dione (PubChem CID 162411064) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3aS,4aS,8aS,9aR)-4a,9,9-trimethyl-4,6,7,8,8a,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxole-2,5-dione.
| Compound Name | (3aS,4aS,8aS,9aR)-4a,9,9-trimethyl-4,6,7,8,8a,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxole-2,5-dione |
|---|---|
| PubChem CID | 162411064 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3aS,4aS,8aS,9aR)-4a,9,9-trimethyl-4,6,7,8,8a,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxole-2,5-dione |
| SMILES | CC1(C)[C@H]2OC(=O)O[C@H]2C[C@]2(C)C(=O)CCC[C@@H]12 |
| InChI | InChI=1S/C14H20O4/c1-13(2)9-5-4-6-10(15)14(9,3)7-8-11(13)18-12(16)17-8/h8-9,11H,4-7H2,1-3H3/t8-,9-,11-,14-/m0/s1 |
| InChIKey | IHXBFYVIHULIDO-KJWJVKQFSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |