C14H24O5 — CID 177402491
(4aS,5R,8aS)-4a,5-dihydroxy-8a-[2-(methoxymethoxy)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 177402491) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (4aS,5R,8aS)-4a,5-dihydroxy-8a-[2-(methoxymethoxy)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,5R,8aS)-4a,5-dihydroxy-8a-[2-(methoxymethoxy)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 177402491 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (4aS,5R,8aS)-4a,5-dihydroxy-8a-[2-(methoxymethoxy)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | COCOCC[C@@]12CCC[C@@H](O)[C@]1(O)CCCC2=O |
| InChI | InChI=1S/C14H24O5/c1-18-10-19-9-8-13-6-2-5-12(16)14(13,17)7-3-4-11(13)15/h12,16-17H,2-10H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | JRXWSFBATHUNIL-MGPQQGTHSA-N |
| XLogP | 1.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|