C23H21ClO3S — CID 118222144
ethyl 2-[2-(4-chlorophenyl)-5-(3-phenylpropanoyl)thiophen-3-yl]acetate (PubChem CID 118222144) has the molecular formula C23H21ClO3S and a molecular weight of 412.94 g/mol. Its IUPAC name is ethyl 2-[2-(4-chlorophenyl)-5-(3-phenylpropanoyl)thiophen-3-yl]acetate.
| Compound Name | ethyl 2-[2-(4-chlorophenyl)-5-(3-phenylpropanoyl)thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 118222144 |
| Molecular Formula | C23H21ClO3S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | ethyl 2-[2-(4-chlorophenyl)-5-(3-phenylpropanoyl)thiophen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(=O)CCc2ccccc2)sc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClO3S/c1-2-27-22(26)15-18-14-21(20(25)13-8-16-6-4-3-5-7-16)28-23(18)17-9-11-19(24)12-10-17/h3-7,9-12,14H,2,8,13,15H2,1H3 |
| InChIKey | XCDGSZMAVNPMLO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |