C22H29N3O6 — CID 118225947
N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(3-methoxyphenyl)furan-2-carboxamide (PubChem CID 118225947) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(3-methoxyphenyl)furan-2-carboxamide.
| Compound Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(3-methoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 118225947 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(3-methoxyphenyl)furan-2-carboxamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NCNC(=O)c1ccc(-c2cccc(OC)c2)o1 |
| InChI | InChI=1S/C22H29N3O6/c1-3-4-5-7-17(13-25(29)15-26)21(27)23-14-24-22(28)20-11-10-19(31-20)16-8-6-9-18(12-16)30-2/h6,8-12,15,17,29H,3-5,7,13-14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | UXVMHWJFIGWLII-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|